C29H39N5O2 — CID 143820633
5-amino-2-[[4-[2-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile (PubChem CID 143820633) has the molecular formula C29H39N5O2 and a molecular weight of 489.66 g/mol. Its IUPAC name is 5-amino-2-[[4-[2-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile.
| Compound Name | 5-amino-2-[[4-[2-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
|---|---|
| PubChem CID | 143820633 |
| Molecular Formula | C29H39N5O2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | 5-amino-2-[[4-[2-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-oxoethoxy]cyclohexyl]amino]benzonitrile |
| SMILES | CC(C)(C)c1ccc(N2CCN(C(=O)COC3CCC(Nc4ccc(N)cc4C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H39N5O2/c1-29(2,3)22-4-9-25(10-5-22)33-14-16-34(17-15-33)28(35)20-36-26-11-7-24(8-12-26)32-27-13-6-23(31)18-21(27)19-30/h4-6,9-10,13,18,24,26,32H,7-8,11-12,14-17,20,31H2,1-3H3 |
| InChIKey | BLHDTJSGJCVCHK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|