C19H25N3O2 — CID 51087251
4-[4-(2-cyclopentyloxyacetyl)-1,4-diazepan-1-yl]benzonitrile (PubChem CID 51087251) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[4-(2-cyclopentyloxyacetyl)-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(2-cyclopentyloxyacetyl)-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 51087251 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-[4-(2-cyclopentyloxyacetyl)-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(C(=O)COC3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C19H25N3O2/c20-14-16-6-8-17(9-7-16)21-10-3-11-22(13-12-21)19(23)15-24-18-4-1-2-5-18/h6-9,18H,1-5,10-13,15H2 |
| InChIKey | UIVXRACADQKEOD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |