C26H31F3N2O3 — CID 90261225
2-cyclohexyloxy-1-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]ethanone (PubChem CID 90261225) has the molecular formula C26H31F3N2O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 2-cyclohexyloxy-1-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-cyclohexyloxy-1-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90261225 |
| Molecular Formula | C26H31F3N2O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-cyclohexyloxy-1-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]ethanone |
| SMILES | O=C(COC1CCCCC1)N1CCN(c2ccc(OCc3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H31F3N2O3/c27-26(28,29)21-8-6-20(7-9-21)18-33-24-12-10-22(11-13-24)30-14-16-31(17-15-30)25(32)19-34-23-4-2-1-3-5-23/h6-13,23H,1-5,14-19H2 |
| InChIKey | GVIOKGIIKGDGOQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|