C27H27N3O3 — CID 55720577
4-[4-[2-(4-phenylmethoxyphenoxy)acetyl]-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55720577) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-[4-[2-(4-phenylmethoxyphenoxy)acetyl]-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-[2-(4-phenylmethoxyphenoxy)acetyl]-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55720577 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 4-[4-[2-(4-phenylmethoxyphenoxy)acetyl]-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(C(=O)COc3ccc(OCc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H27N3O3/c28-19-22-7-9-24(10-8-22)29-15-4-16-30(18-17-29)27(31)21-33-26-13-11-25(12-14-26)32-20-23-5-2-1-3-6-23/h1-3,5-14H,4,15-18,20-21H2 |
| InChIKey | PAZCNKRYZROLOY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |