C26H27N3O2 — CID 55716214
4-[4-(4-naphthalen-1-yloxybutanoyl)-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55716214) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-[4-(4-naphthalen-1-yloxybutanoyl)-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(4-naphthalen-1-yloxybutanoyl)-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55716214 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 4-[4-(4-naphthalen-1-yloxybutanoyl)-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(C(=O)CCCOc3cccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C26H27N3O2/c27-20-21-11-13-23(14-12-21)28-15-5-16-29(18-17-28)26(30)10-4-19-31-25-9-3-7-22-6-1-2-8-24(22)25/h1-3,6-9,11-14H,4-5,10,15-19H2 |
| InChIKey | HHQMQHVJPRDFBU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|