C25H23N3O — CID 55715944
4-[4-[(E)-3-naphthalen-1-ylprop-2-enoyl]-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55715944) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[4-[(E)-3-naphthalen-1-ylprop-2-enoyl]-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-[(E)-3-naphthalen-1-ylprop-2-enoyl]-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55715944 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-[4-[(E)-3-naphthalen-1-ylprop-2-enoyl]-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(C(=O)/C=C/c3cccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C25H23N3O/c26-19-20-9-12-23(13-10-20)27-15-4-16-28(18-17-27)25(29)14-11-22-7-3-6-21-5-1-2-8-24(21)22/h1-3,5-14H,4,15-18H2/b14-11+ |
| InChIKey | BJJMTSWWGDRNCW-SDNWHVSQSA-N |
| XLogP | 4.46 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|