C22H21Cl2N3O — CID 37277949
4-[[4-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 37277949) has the molecular formula C22H21Cl2N3O and a molecular weight of 414.34 g/mol. Its IUPAC name is 4-[[4-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 37277949 |
| Molecular Formula | C22H21Cl2N3O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-[[4-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCCN(C(=O)/C=C/c3cccc(Cl)c3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H21Cl2N3O/c23-20-4-1-3-19(22(20)24)9-10-21(28)27-12-2-11-26(13-14-27)16-18-7-5-17(15-25)6-8-18/h1,3-10H,2,11-14,16H2/b10-9+ |
| InChIKey | FZJHPIVBLGBULI-MDZDMXLPSA-N |
| XLogP | 4.61 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|