C27H25N3O2 — CID 17492366
4-[[4-(2-benzoylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 17492366) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-[[4-(2-benzoylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(2-benzoylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 17492366 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-[[4-(2-benzoylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCCN(C(=O)c3ccccc3C(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H25N3O2/c28-19-21-11-13-22(14-12-21)20-29-15-6-16-30(18-17-29)27(32)25-10-5-4-9-24(25)26(31)23-7-2-1-3-8-23/h1-5,7-14H,6,15-18,20H2 |
| InChIKey | BPPSKDHQKGGUCC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |