C22H25N3O — CID 51331648
4-[[4-(4-ethylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 51331648) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-[[4-(4-ethylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(4-ethylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 51331648 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 4-[[4-(4-ethylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | CCc1ccc(C(=O)N2CCCN(Cc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-2-18-8-10-21(11-9-18)22(26)25-13-3-12-24(14-15-25)17-20-6-4-19(16-23)5-7-20/h4-11H,2-3,12-15,17H2,1H3 |
| InChIKey | OITCOUSGIGNGMM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |