C23H21ClN4O — CID 55821462
4-[[4-(2-chloroquinoline-6-carbonyl)-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 55821462) has the molecular formula C23H21ClN4O and a molecular weight of 404.90 g/mol. Its IUPAC name is 4-[[4-(2-chloroquinoline-6-carbonyl)-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(2-chloroquinoline-6-carbonyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 55821462 |
| Molecular Formula | C23H21ClN4O |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 4-[[4-(2-chloroquinoline-6-carbonyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCCN(C(=O)c3ccc4nc(Cl)ccc4c3)CC2)cc1 |
| InChI | InChI=1S/C23H21ClN4O/c24-22-9-7-19-14-20(6-8-21(19)26-22)23(29)28-11-1-10-27(12-13-28)16-18-4-2-17(15-25)3-5-18/h2-9,14H,1,10-13,16H2 |
| InChIKey | AFDLIXUQEMWSPQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|