C23H25N5O3 — CID 41388340
4-[[4-[4-(cyclopropylamino)-3-nitrobenzoyl]-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 41388340) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 4-[[4-[4-(cyclopropylamino)-3-nitrobenzoyl]-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[4-(cyclopropylamino)-3-nitrobenzoyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 41388340 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-[[4-[4-(cyclopropylamino)-3-nitrobenzoyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCCN(C(=O)c3ccc(NC4CC4)c([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C23H25N5O3/c24-15-17-2-4-18(5-3-17)16-26-10-1-11-27(13-12-26)23(29)19-6-9-21(25-20-7-8-20)22(14-19)28(30)31/h2-6,9,14,20,25H,1,7-8,10-13,16H2 |
| InChIKey | VAPCEVXTGFQDEE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|