C22H25N3O — CID 37277247
4-[[4-(2,3-dimethylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 37277247) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-[[4-(2,3-dimethylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(2,3-dimethylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 37277247 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 4-[[4-(2,3-dimethylbenzoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | Cc1cccc(C(=O)N2CCCN(Cc3ccc(C#N)cc3)CC2)c1C |
| InChI | InChI=1S/C22H25N3O/c1-17-5-3-6-21(18(17)2)22(26)25-12-4-11-24(13-14-25)16-20-9-7-19(15-23)8-10-20/h3,5-10H,4,11-14,16H2,1-2H3 |
| InChIKey | FGCDZNSFPSKYFX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |