C27H30N4O2 — CID 37279739
4-[[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 37279739) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 37279739 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-[[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)N3CCCN(Cc4ccc(C#N)cc4)CC3)c2C)cc1 |
| InChI | InChI=1S/C27H30N4O2/c1-20-17-26(21(2)31(20)24-9-11-25(33-3)12-10-24)27(32)30-14-4-13-29(15-16-30)19-23-7-5-22(18-28)6-8-23/h5-12,17H,4,13-16,19H2,1-3H3 |
| InChIKey | ARPTZBTYTVWOIH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 61.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|