C25H36N4O3 — CID 78863289
N,N-diethyl-2-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 78863289) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N,N-diethyl-2-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 78863289 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N,N-diethyl-2-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | CCN(CC)C(=O)CN1CCCN(C(=O)c2cc(C)n(-c3ccc(OC)cc3)c2C)CC1 |
| InChI | InChI=1S/C25H36N4O3/c1-6-27(7-2)24(30)18-26-13-8-14-28(16-15-26)25(31)23-17-19(3)29(20(23)4)21-9-11-22(32-5)12-10-21/h9-12,17H,6-8,13-16,18H2,1-5H3 |
| InChIKey | KAFJVSDKOSCQBW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|