C23H27N3O2 — CID 31118906
4-[[4-(4-phenoxybutanoyl)-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 31118906) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[[4-(4-phenoxybutanoyl)-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(4-phenoxybutanoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 31118906 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-[[4-(4-phenoxybutanoyl)-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCCN(C(=O)CCCOc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c24-18-20-9-11-21(12-10-20)19-25-13-5-14-26(16-15-25)23(27)8-4-17-28-22-6-2-1-3-7-22/h1-3,6-7,9-12H,4-5,8,13-17,19H2 |
| InChIKey | CLSONUIYOKSART-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|