C21H27Cl2N3O2 — CID 55564539
(E)-3-(2,3-dichlorophenyl)-1-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 55564539) has the molecular formula C21H27Cl2N3O2 and a molecular weight of 424.37 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-1-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-1-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55564539 |
| Molecular Formula | C21H27Cl2N3O2 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-1-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | CC1CCCCN1C(=O)CN1CCN(C(=O)/C=C/c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C21H27Cl2N3O2/c1-16-5-2-3-10-26(16)20(28)15-24-11-13-25(14-12-24)19(27)9-8-17-6-4-7-18(22)21(17)23/h4,6-9,16H,2-3,5,10-15H2,1H3/b9-8+ |
| InChIKey | CKQKLQXNPZZJJO-CMDGGOBGSA-N |
| XLogP | 3.55 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|