C24H26ClN3O3 — CID 55716157
4-[4-[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55716157) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is 4-[4-[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55716157 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 4-[4-[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]benzonitrile |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)N2CCCN(c3ccc(C#N)cc3)CC2)cc1OC |
| InChI | InChI=1S/C24H26ClN3O3/c1-3-31-24-21(25)15-19(16-22(24)30-2)7-10-23(29)28-12-4-11-27(13-14-28)20-8-5-18(17-26)6-9-20/h5-10,15-16H,3-4,11-14H2,1-2H3/b10-7+ |
| InChIKey | PGVJYGYEOTVAKM-JXMROGBWSA-N |
| XLogP | 4.37 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|