C19H18IN3O — CID 55715908
4-[4-(2-iodobenzoyl)-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55715908) has the molecular formula C19H18IN3O and a molecular weight of 431.28 g/mol. Its IUPAC name is 4-[4-(2-iodobenzoyl)-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(2-iodobenzoyl)-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55715908 |
| Molecular Formula | C19H18IN3O |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 4-[4-(2-iodobenzoyl)-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(C(=O)c3ccccc3I)CC2)cc1 |
| InChI | InChI=1S/C19H18IN3O/c20-18-5-2-1-4-17(18)19(24)23-11-3-10-22(12-13-23)16-8-6-15(14-21)7-9-16/h1-2,4-9H,3,10-13H2 |
| InChIKey | HJSVNKICSUNMRI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|