C25H26N4O — CID 55720896
4-[4-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55720896) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-[4-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55720896 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-[4-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(C(=O)c3cccc4c5c([nH]c34)CCCC5)CC2)cc1 |
| InChI | InChI=1S/C25H26N4O/c26-17-18-9-11-19(12-10-18)28-13-4-14-29(16-15-28)25(30)22-7-3-6-21-20-5-1-2-8-23(20)27-24(21)22/h3,6-7,9-12,27H,1-2,4-5,8,13-16H2 |
| InChIKey | INJBWDWWOACRDE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|