C23H26N4O — CID 90651430
[4-(5-methylpyrimidin-4-yl)piperidin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone (PubChem CID 90651430) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is [4-(5-methylpyrimidin-4-yl)piperidin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone.
| Compound Name | [4-(5-methylpyrimidin-4-yl)piperidin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone |
|---|---|
| PubChem CID | 90651430 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [4-(5-methylpyrimidin-4-yl)piperidin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone |
| SMILES | Cc1cncnc1C1CCN(C(=O)c2cccc3c4c([nH]c23)CCCC4)CC1 |
| InChI | InChI=1S/C23H26N4O/c1-15-13-24-14-25-21(15)16-9-11-27(12-10-16)23(28)19-7-4-6-18-17-5-2-3-8-20(17)26-22(18)19/h4,6-7,13-14,16,26H,2-3,5,8-12H2,1H3 |
| InChIKey | TUHPJPJHOBILGW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|