C21H22ClN3O3S2 — CID 46581850
[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone (PubChem CID 46581850) has the molecular formula C21H22ClN3O3S2 and a molecular weight of 464.01 g/mol. Its IUPAC name is [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone.
| Compound Name | [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone |
|---|---|
| PubChem CID | 46581850 |
| Molecular Formula | C21H22ClN3O3S2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone |
| SMILES | O=C(c1cccc2c3c([nH]c12)CCCC3)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C21H22ClN3O3S2/c22-18-8-9-19(29-18)30(27,28)25-12-10-24(11-13-25)21(26)16-6-3-5-15-14-4-1-2-7-17(14)23-20(15)16/h3,5-6,8-9,23H,1-2,4,7,10-13H2 |
| InChIKey | YEHHYKMBRGTYNK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|