C21H20ClN3O3S2 — CID 27768627
(2-anilinophenyl)-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 27768627) has the molecular formula C21H20ClN3O3S2 and a molecular weight of 462.00 g/mol. Its IUPAC name is (2-anilinophenyl)-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2-anilinophenyl)-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27768627 |
| Molecular Formula | C21H20ClN3O3S2 |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (2-anilinophenyl)-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Nc1ccccc1)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C21H20ClN3O3S2/c22-19-10-11-20(29-19)30(27,28)25-14-12-24(13-15-25)21(26)17-8-4-5-9-18(17)23-16-6-2-1-3-7-16/h1-11,23H,12-15H2 |
| InChIKey | BLSYSJQVDYPMOH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |