C23H24ClN3O — CID 37253115
[4-(2-chlorophenyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone (PubChem CID 37253115) has the molecular formula C23H24ClN3O and a molecular weight of 393.92 g/mol. Its IUPAC name is [4-(2-chlorophenyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone.
| Compound Name | [4-(2-chlorophenyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone |
|---|---|
| PubChem CID | 37253115 |
| Molecular Formula | C23H24ClN3O |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [4-(2-chlorophenyl)piperazin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone |
| SMILES | O=C(c1cccc2c3c([nH]c12)CCCC3)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H24ClN3O/c24-19-9-2-4-11-21(19)26-12-14-27(15-13-26)23(28)18-8-5-7-17-16-6-1-3-10-20(16)25-22(17)18/h2,4-5,7-9,11,25H,1,3,6,10,12-15H2 |
| InChIKey | ISAYNSROIVASRA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|