C23H25N3O2 — CID 135110871
[(3R,4R)-3-hydroxy-4-(pyridin-4-ylmethyl)pyrrolidin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone (PubChem CID 135110871) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is [(3R,4R)-3-hydroxy-4-(pyridin-4-ylmethyl)pyrrolidin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone.
| Compound Name | [(3R,4R)-3-hydroxy-4-(pyridin-4-ylmethyl)pyrrolidin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone |
|---|---|
| PubChem CID | 135110871 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [(3R,4R)-3-hydroxy-4-(pyridin-4-ylmethyl)pyrrolidin-1-yl]-(6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanone |
| SMILES | O=C(c1cccc2c3c([nH]c12)CCCC3)N1C[C@@H](Cc2ccncc2)[C@@H](O)C1 |
| InChI | InChI=1S/C23H25N3O2/c27-21-14-26(13-16(21)12-15-8-10-24-11-9-15)23(28)19-6-3-5-18-17-4-1-2-7-20(17)25-22(18)19/h3,5-6,8-11,16,21,25,27H,1-2,4,7,12-14H2/t16-,21+/m1/s1 |
| InChIKey | QJWLDNRXODSWKE-IERDGZPVSA-N |
| XLogP | 3.12 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|