C21H25N5O — CID 146090949
6,7,8,9-tetrahydro-5H-carbazol-1-yl-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methanone (PubChem CID 146090949) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-carbazol-1-yl-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | 6,7,8,9-tetrahydro-5H-carbazol-1-yl-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 146090949 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-carbazol-1-yl-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc2c3c([nH]c12)CCCC3)N1CCC(Cn2cncn2)CC1 |
| InChI | InChI=1S/C21H25N5O/c27-21(25-10-8-15(9-11-25)12-26-14-22-13-23-26)18-6-3-5-17-16-4-1-2-7-19(16)24-20(17)18/h3,5-6,13-15,24H,1-2,4,7-12H2 |
| InChIKey | YDGAHSTVOWTUOO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|