C19H23N3O3 — CID 99564791
[(2R)-1-carbamoylpyrrolidin-2-yl]methyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate (PubChem CID 99564791) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(2R)-1-carbamoylpyrrolidin-2-yl]methyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate.
| Compound Name | [(2R)-1-carbamoylpyrrolidin-2-yl]methyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate |
|---|---|
| PubChem CID | 99564791 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [(2R)-1-carbamoylpyrrolidin-2-yl]methyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate |
| SMILES | NC(=O)N1CCC[C@@H]1COC(=O)c1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C19H23N3O3/c20-19(24)22-10-4-5-12(22)11-25-18(23)15-8-3-7-14-13-6-1-2-9-16(13)21-17(14)15/h3,7-8,12,21H,1-2,4-6,9-11H2,(H2,20,24)/t12-/m1/s1 |
| InChIKey | XEXLISBNEYFYBC-GFCCVEGCSA-N |
| XLogP | 2.75 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|