C20H23N3O2 — CID 56799241
3-(1-methylpyrazol-4-yl)propyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate (PubChem CID 56799241) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)propyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate.
| Compound Name | 3-(1-methylpyrazol-4-yl)propyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate |
|---|---|
| PubChem CID | 56799241 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)propyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate |
| SMILES | Cn1cc(CCCOC(=O)c2cccc3c4c([nH]c23)CCCC4)cn1 |
| InChI | InChI=1S/C20H23N3O2/c1-23-13-14(12-21-23)6-5-11-25-20(24)17-9-4-8-16-15-7-2-3-10-18(15)22-19(16)17/h4,8-9,12-13,22H,2-3,5-7,10-11H2,1H3 |
| InChIKey | FINYMNRZXCTBNV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|