C25H25N5O3 — CID 46586481
N'-(4-oxo-3-propylphthalazine-1-carbonyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carbohydrazide (PubChem CID 46586481) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is N'-(4-oxo-3-propylphthalazine-1-carbonyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carbohydrazide.
| Compound Name | N'-(4-oxo-3-propylphthalazine-1-carbonyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carbohydrazide |
|---|---|
| PubChem CID | 46586481 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N'-(4-oxo-3-propylphthalazine-1-carbonyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carbohydrazide |
| SMILES | CCCn1nc(C(=O)NNC(=O)c2cccc3c4c([nH]c23)CCCC4)c2ccccc2c1=O |
| InChI | InChI=1S/C25H25N5O3/c1-2-14-30-25(33)18-10-4-3-9-17(18)22(29-30)24(32)28-27-23(31)19-12-7-11-16-15-8-5-6-13-20(15)26-21(16)19/h3-4,7,9-12,26H,2,5-6,8,13-14H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | MXSRIBGIHBBPGE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|