C25H24ClN5O3 — CID 33222868
N'-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide (PubChem CID 33222868) has the molecular formula C25H24ClN5O3 and a molecular weight of 477.95 g/mol. Its IUPAC name is N'-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide.
| Compound Name | N'-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 33222868 |
| Molecular Formula | C25H24ClN5O3 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N'-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide |
| SMILES | CCCn1nc(C(=O)NNC(=O)c2cc(-n3c(C)ccc3C)ccc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C25H24ClN5O3/c1-4-13-30-25(34)19-8-6-5-7-18(19)22(29-30)24(33)28-27-23(32)20-14-17(11-12-21(20)26)31-15(2)9-10-16(31)3/h5-12,14H,4,13H2,1-3H3,(H,27,32)(H,28,33) |
| InChIKey | VWIXOWUXDHVBHG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|