C18H15Cl2N3O2 — CID 2506129
N-(2,5-dichlorophenyl)-4-oxo-3-propylphthalazine-1-carboxamide (PubChem CID 2506129) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-oxo-3-propylphthalazine-1-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-oxo-3-propylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 2506129 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-oxo-3-propylphthalazine-1-carboxamide |
| SMILES | CCCn1nc(C(=O)Nc2cc(Cl)ccc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C18H15Cl2N3O2/c1-2-9-23-18(25)13-6-4-3-5-12(13)16(22-23)17(24)21-15-10-11(19)7-8-14(15)20/h3-8,10H,2,9H2,1H3,(H,21,24) |
| InChIKey | HJQNGTXLEKGZDM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |