C17H13BrClN3O2 — CID 7924369
N-(4-bromo-2-chlorophenyl)-3-ethyl-4-oxophthalazine-1-carboxamide (PubChem CID 7924369) has the molecular formula C17H13BrClN3O2 and a molecular weight of 406.67 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-3-ethyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-3-ethyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 7924369 |
| Molecular Formula | C17H13BrClN3O2 |
| Molecular Weight | 406.67 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-3-ethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCn1nc(C(=O)Nc2ccc(Br)cc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C17H13BrClN3O2/c1-2-22-17(24)12-6-4-3-5-11(12)15(21-22)16(23)20-14-8-7-10(18)9-13(14)19/h3-9H,2H2,1H3,(H,20,23) |
| InChIKey | WNONSZDNXOXNFR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |