C20H18ClNO2 — CID 50888463
(2-chlorophenyl)methyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate (PubChem CID 50888463) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate.
| Compound Name | (2-chlorophenyl)methyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate |
|---|---|
| PubChem CID | 50888463 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2-chlorophenyl)methyl 6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1Cl)c1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C20H18ClNO2/c21-17-10-3-1-6-13(17)12-24-20(23)16-9-5-8-15-14-7-2-4-11-18(14)22-19(15)16/h1,3,5-6,8-10,22H,2,4,7,11-12H2 |
| InChIKey | OYIYODGXYXGQFQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|