C23H25ClN2O3 — CID 23470239
(2-chloro-4-methoxyphenyl)methyl 6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate (PubChem CID 23470239) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is (2-chloro-4-methoxyphenyl)methyl 6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate.
| Compound Name | (2-chloro-4-methoxyphenyl)methyl 6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate |
|---|---|
| PubChem CID | 23470239 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2-chloro-4-methoxyphenyl)methyl 6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylate |
| SMILES | COc1ccc(COC(=O)c2cccc3c4c([nH]c23)CCC(N(C)C)C4)c(Cl)c1 |
| InChI | InChI=1S/C23H25ClN2O3/c1-26(2)15-8-10-21-19(11-15)17-5-4-6-18(22(17)25-21)23(27)29-13-14-7-9-16(28-3)12-20(14)24/h4-7,9,12,15,25H,8,10-11,13H2,1-3H3 |
| InChIKey | WQKMNVWCOPNNCP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|