C15H20N2S — CID 129396498
(3R)-N,N-dimethyl-8-methylsulfanyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 129396498) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is (3R)-N,N-dimethyl-8-methylsulfanyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | (3R)-N,N-dimethyl-8-methylsulfanyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 129396498 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (3R)-N,N-dimethyl-8-methylsulfanyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | CSc1cccc2c3c([nH]c12)CC[C@@H](N(C)C)C3 |
| InChI | InChI=1S/C15H20N2S/c1-17(2)10-7-8-13-12(9-10)11-5-4-6-14(18-3)15(11)16-13/h4-6,10,16H,7-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | FYHTZOKZGTVVRI-SNVBAGLBSA-N |
| XLogP | 3.31 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|