C21H23FN2O — CID 23340474
7-fluoro-N,N-dimethyl-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 23340474) has the molecular formula C21H23FN2O and a molecular weight of 338.43 g/mol. Its IUPAC name is 7-fluoro-N,N-dimethyl-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | 7-fluoro-N,N-dimethyl-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 23340474 |
| Molecular Formula | C21H23FN2O |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 7-fluoro-N,N-dimethyl-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | CN(C)C1CCc2[nH]c3cc(F)c(OCc4ccccc4)cc3c2C1 |
| InChI | InChI=1S/C21H23FN2O/c1-24(2)15-8-9-19-16(10-15)17-11-21(18(22)12-20(17)23-19)25-13-14-6-4-3-5-7-14/h3-7,11-12,15,23H,8-10,13H2,1-2H3 |
| InChIKey | DQLGMERDPOLHFH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|