C22H24N2O2 — CID 23470321
[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-1-yl]methyl benzoate (PubChem CID 23470321) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is [6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-1-yl]methyl benzoate.
| Compound Name | [6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 23470321 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-1-yl]methyl benzoate |
| SMILES | CN(C)C1CCc2[nH]c3c(COC(=O)c4ccccc4)cccc3c2C1 |
| InChI | InChI=1S/C22H24N2O2/c1-24(2)17-11-12-20-19(13-17)18-10-6-9-16(21(18)23-20)14-26-22(25)15-7-4-3-5-8-15/h3-10,17,23H,11-14H2,1-2H3 |
| InChIKey | KVDGFDLTDCQEHP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|