C25H21NO3 — CID 23470459
(8-phenoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl) benzoate (PubChem CID 23470459) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is (8-phenoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl) benzoate.
| Compound Name | (8-phenoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl) benzoate |
|---|---|
| PubChem CID | 23470459 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (8-phenoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl) benzoate |
| SMILES | O=C(OC1CCc2[nH]c3c(Oc4ccccc4)cccc3c2C1)c1ccccc1 |
| InChI | InChI=1S/C25H21NO3/c27-25(17-8-3-1-4-9-17)29-19-14-15-22-21(16-19)20-12-7-13-23(24(20)26-22)28-18-10-5-2-6-11-18/h1-13,19,26H,14-16H2 |
| InChIKey | CKKSJJPFRWCQFT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|