C17H14FNO2 — CID 22641455
6-fluoro-2-methyl-7-phenylmethoxy-1H-quinolin-4-one (PubChem CID 22641455) has the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. Its IUPAC name is 6-fluoro-2-methyl-7-phenylmethoxy-1H-quinolin-4-one.
| Compound Name | 6-fluoro-2-methyl-7-phenylmethoxy-1H-quinolin-4-one |
|---|---|
| PubChem CID | 22641455 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 6-fluoro-2-methyl-7-phenylmethoxy-1H-quinolin-4-one |
| SMILES | Cc1cc(=O)c2cc(F)c(OCc3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C17H14FNO2/c1-11-7-16(20)13-8-14(18)17(9-15(13)19-11)21-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,19,20) |
| InChIKey | JHKAPLOQRUDNCL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |