C26H24FNO6 — CID 67622122
ethyl [3-(3-fluoro-4-methoxyphenyl)-5-methoxy-6-phenylmethoxy-1H-indol-2-yl] carbonate (PubChem CID 67622122) has the molecular formula C26H24FNO6 and a molecular weight of 465.48 g/mol. Its IUPAC name is ethyl [3-(3-fluoro-4-methoxyphenyl)-5-methoxy-6-phenylmethoxy-1H-indol-2-yl] carbonate.
| Compound Name | ethyl [3-(3-fluoro-4-methoxyphenyl)-5-methoxy-6-phenylmethoxy-1H-indol-2-yl] carbonate |
|---|---|
| PubChem CID | 67622122 |
| Molecular Formula | C26H24FNO6 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | ethyl [3-(3-fluoro-4-methoxyphenyl)-5-methoxy-6-phenylmethoxy-1H-indol-2-yl] carbonate |
| SMILES | CCOC(=O)Oc1[nH]c2cc(OCc3ccccc3)c(OC)cc2c1-c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C26H24FNO6/c1-4-32-26(29)34-25-24(17-10-11-21(30-2)19(27)12-17)18-13-22(31-3)23(14-20(18)28-25)33-15-16-8-6-5-7-9-16/h5-14,28H,4,15H2,1-3H3 |
| InChIKey | OLSGACMGMIKWML-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |