C12H14ClNO3 — CID 91665124
6,7-dimethoxy-2-methyl-1H-quinolin-4-one;hydrochloride (PubChem CID 91665124) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-1H-quinolin-4-one;hydrochloride.
| Compound Name | 6,7-dimethoxy-2-methyl-1H-quinolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 91665124 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-1H-quinolin-4-one;hydrochloride |
| SMILES | COc1cc2[nH]c(C)cc(=O)c2cc1OC.Cl |
| InChI | InChI=1S/C12H13NO3.ClH/c1-7-4-10(14)8-5-11(15-2)12(16-3)6-9(8)13-7;/h4-6H,1-3H3,(H,13,14);1H |
| InChIKey | AICUAUDTPJYESJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |