C20H20O5 — CID 102205474
4,5,13,14-tetramethoxy-10-methyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,9,11,13-heptaen-8-one (PubChem CID 102205474) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4,5,13,14-tetramethoxy-10-methyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 4,5,13,14-tetramethoxy-10-methyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 102205474 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 4,5,13,14-tetramethoxy-10-methyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,9,11,13-heptaen-8-one |
| SMILES | COc1cc2c(C)cc(=O)c3cc(OC)c(OC)cc3c2cc1OC |
| InChI | InChI=1S/C20H20O5/c1-11-6-16(21)15-10-20(25-5)19(24-4)9-14(15)13-8-18(23-3)17(22-2)7-12(11)13/h6-10H,1-5H3 |
| InChIKey | BCYYMZGTLUTIPK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |