C4H4O2 — CID 140769587
2-methoxycycloprop-2-en-1-one (PubChem CID 140769587) has the molecular formula C4H4O2 and a molecular weight of 84.07 g/mol. Its IUPAC name is 2-methoxycycloprop-2-en-1-one.
| Compound Name | 2-methoxycycloprop-2-en-1-one |
|---|---|
| PubChem CID | 140769587 |
| Molecular Formula | C4H4O2 |
| Molecular Weight | 84.07 g/mol |
| Exact Mass | 84.02 |
| IUPAC Name | 2-methoxycycloprop-2-en-1-one |
| SMILES | COc1cc1=O |
| InChI | InChI=1S/C4H4O2/c1-6-4-2-3(4)5/h2H,1H3 |
| InChIKey | YPPXJQAHVAUMGH-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 84.07 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |