C22H20O8 — CID 159563577
6,7-dimethoxychromen-2-one (PubChem CID 159563577) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is 6,7-dimethoxychromen-2-one.
| Compound Name | 6,7-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 159563577 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 6,7-dimethoxychromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2cc1OC.COc1cc2ccc(=O)oc2cc1OC |
| InChI | InChI=1S/2C11H10O4/c2*1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h2*3-6H,1-2H3 |
| InChIKey | MGXRDURKQAWOAS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 97.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|