C14H14O6 — CID 54430844
4-(7-methoxy-2-oxochromen-6-yl)oxybutanoic acid (PubChem CID 54430844) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 4-(7-methoxy-2-oxochromen-6-yl)oxybutanoic acid.
| Compound Name | 4-(7-methoxy-2-oxochromen-6-yl)oxybutanoic acid |
|---|---|
| PubChem CID | 54430844 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-(7-methoxy-2-oxochromen-6-yl)oxybutanoic acid |
| SMILES | COc1cc2oc(=O)ccc2cc1OCCCC(=O)O |
| InChI | InChI=1S/C14H14O6/c1-18-11-8-10-9(4-5-14(17)20-10)7-12(11)19-6-2-3-13(15)16/h4-5,7-8H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | WHJAKBNRVVGKTR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|