About 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one
7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one (PubChem CID 158863716) has the molecular formula C19H14O7
and a molecular weight of 354.31 g/mol. Its IUPAC name is 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one.
Molecular Properties
| Compound Name | 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one |
| PubChem CID | 158863716 |
| Molecular Formula | C19H14O7 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2cc1O.O=c1ccc2ccc(O)cc2o1 |
| InChI | InChI=1S/C10H8O4.C9H6O3/c1-13-9-4-6-2-3-10(12)14-8(6)5-7(9)11;10-7-3-1-6-2-4-9(11)12-8(6)5-7/h2-5,11H,1H3;1-5,10H |
| InChIKey | JAYQROBPZXXWFV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one?
The IUPAC name of 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one (CID 158863716) is 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one.
What is the SMILES notation for 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one?
The canonical SMILES for 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one is COc1cc2ccc(=O)oc2cc1O.O=c1ccc2ccc(O)cc2o1.
What is the InChIKey of 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one?
The InChIKey is JAYQROBPZXXWFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4.C9H6O3/c1-13-9-4-6-2-3-10(12)14-8(6)5-7(9)11;10-7-3-1-6-2-4-9(11)12-8(6)5-7/h2-5,11H,1H3;1-5,10H.
What are the key properties of 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one?
7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one has a molecular weight of 354.31 g/mol, XLogP of 3.01, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxychromen-2-one;7-hydroxy-6-methoxychromen-2-one is sourced from PubChem (CID 158863716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).