About sodium;6,7-dimethoxychromen-2-one;chloride
sodium;6,7-dimethoxychromen-2-one;chloride (PubChem CID 174522152) has the molecular formula C11H10ClNaO4
and a molecular weight of 264.64 g/mol. Its IUPAC name is sodium;6,7-dimethoxychromen-2-one;chloride.
Molecular Properties
| Compound Name | sodium;6,7-dimethoxychromen-2-one;chloride |
| PubChem CID | 174522152 |
| Molecular Formula | C11H10ClNaO4 |
| Molecular Weight | 264.64 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | sodium;6,7-dimethoxychromen-2-one;chloride |
| SMILES | COc1cc2ccc(=O)oc2cc1OC.[Cl-].[Na+] |
| InChI | InChI=1S/C11H10O4.ClH.Na/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2;;/h3-6H,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | FOKOIPPELVMKPQ-UHFFFAOYSA-M |
| XLogP | -4.18 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.64 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze sodium;6,7-dimethoxychromen-2-one;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;6,7-dimethoxychromen-2-one;chloride?
The IUPAC name of sodium;6,7-dimethoxychromen-2-one;chloride (CID 174522152) is sodium;6,7-dimethoxychromen-2-one;chloride.
What is the SMILES notation for sodium;6,7-dimethoxychromen-2-one;chloride?
The canonical SMILES for sodium;6,7-dimethoxychromen-2-one;chloride is COc1cc2ccc(=O)oc2cc1OC.[Cl-].[Na+].
What is the InChIKey of sodium;6,7-dimethoxychromen-2-one;chloride?
The InChIKey is FOKOIPPELVMKPQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10O4.ClH.Na/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2;;/h3-6H,1-2H3;1H;/q;;+1/p-1.
What are the key properties of sodium;6,7-dimethoxychromen-2-one;chloride?
sodium;6,7-dimethoxychromen-2-one;chloride has a molecular weight of 264.64 g/mol, XLogP of -4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;6,7-dimethoxychromen-2-one;chloride is sourced from PubChem (CID 174522152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).