C12H8O4 — CID 12896811
3-methoxyfuro[3,2-g]chromen-7-one (PubChem CID 12896811) has the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. Its IUPAC name is 3-methoxyfuro[3,2-g]chromen-7-one.
| Compound Name | 3-methoxyfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 12896811 |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 3-methoxyfuro[3,2-g]chromen-7-one |
| SMILES | COc1coc2cc3oc(=O)ccc3cc12 |
| InChI | InChI=1S/C12H8O4/c1-14-11-6-15-10-5-9-7(4-8(10)11)2-3-12(13)16-9/h2-6H,1H3 |
| InChIKey | ZRSSNKQAHFVTPW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|