C15H16O5 — CID 163036838
6-[(2R,3S)-3-(2-hydroxypropan-2-yl)oxiran-2-yl]-7-methoxychromen-2-one (PubChem CID 163036838) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is 6-[(2R,3S)-3-(2-hydroxypropan-2-yl)oxiran-2-yl]-7-methoxychromen-2-one.
| Compound Name | 6-[(2R,3S)-3-(2-hydroxypropan-2-yl)oxiran-2-yl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 163036838 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 6-[(2R,3S)-3-(2-hydroxypropan-2-yl)oxiran-2-yl]-7-methoxychromen-2-one |
| SMILES | COc1cc2oc(=O)ccc2cc1[C@H]1O[C@@H]1C(C)(C)O |
| InChI | InChI=1S/C15H16O5/c1-15(2,17)14-13(20-14)9-6-8-4-5-12(16)19-10(8)7-11(9)18-3/h4-7,13-14,17H,1-3H3/t13-,14+/m1/s1 |
| InChIKey | AOSJNVGGFDRBDQ-KGLIPLIRSA-N |
| XLogP | 2.01 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|