C15H12O6 — CID 163005963
7-methoxy-6-[(1S,2R,5S)-5-methyl-4-oxo-3,6-dioxabicyclo[3.1.0]hexan-2-yl]chromen-2-one (PubChem CID 163005963) has the molecular formula C15H12O6 and a molecular weight of 288.26 g/mol. Its IUPAC name is 7-methoxy-6-[(1S,2R,5S)-5-methyl-4-oxo-3,6-dioxabicyclo[3.1.0]hexan-2-yl]chromen-2-one.
| Compound Name | 7-methoxy-6-[(1S,2R,5S)-5-methyl-4-oxo-3,6-dioxabicyclo[3.1.0]hexan-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 163005963 |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 7-methoxy-6-[(1S,2R,5S)-5-methyl-4-oxo-3,6-dioxabicyclo[3.1.0]hexan-2-yl]chromen-2-one |
| SMILES | COc1cc2oc(=O)ccc2cc1[C@H]1OC(=O)[C@@]2(C)O[C@@H]12 |
| InChI | InChI=1S/C15H12O6/c1-15-13(21-15)12(20-14(15)17)8-5-7-3-4-11(16)19-9(7)6-10(8)18-2/h3-6,12-13H,1-2H3/t12-,13+,15+/m1/s1 |
| InChIKey | VIORQNDMAWQQCV-IPYPFGDCSA-N |
| XLogP | 1.56 |
| TPSA | 78.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|