C16H20O5 — CID 101119214
6-[(2S)-2-hydroxy-3-methoxy-3-methylbutyl]-7-methoxychromen-2-one (PubChem CID 101119214) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 6-[(2S)-2-hydroxy-3-methoxy-3-methylbutyl]-7-methoxychromen-2-one.
| Compound Name | 6-[(2S)-2-hydroxy-3-methoxy-3-methylbutyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 101119214 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 6-[(2S)-2-hydroxy-3-methoxy-3-methylbutyl]-7-methoxychromen-2-one |
| SMILES | COc1cc2oc(=O)ccc2cc1C[C@H](O)C(C)(C)OC |
| InChI | InChI=1S/C16H20O5/c1-16(2,20-4)14(17)8-11-7-10-5-6-15(18)21-13(10)9-12(11)19-3/h5-7,9,14,17H,8H2,1-4H3/t14-/m0/s1 |
| InChIKey | DMWGHNQNZLYMJE-AWEZNQCLSA-N |
| XLogP | 2.13 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|